| General information | Literature | Expression | Regulation | Variant | Interaction |
Basic Information | |
|---|---|
Gene ID | 3303 |
Name | HSPA1A |
Synonymous | HSP70-1|HSP70-1A|HSP70I|HSP72|HSPA1|HSPA1B;heat shock 70kDa protein 1A;HSPA1A;heat shock 70kDa protein 1A |
Definition | HSP70-1/HSP70-2|HSP70.1/HSP70.2|dnaK-type molecular chaperone HSP70-1|heat shock 70 kDa protein 1/2|heat shock 70 kDa protein 1A/1B|heat shock 70kD protein 1A|heat shock-induced protein |
Position | 6p21.3 |
Gene Type | protein-coding |
Gene Regulation: | Transcription Factors Post Translational Modification From dbPTM Methylation Profile From DiseaseMeth database |
Transcription Factors [Top] |
Regulation From TransFac database | Hsp70-1(h) + Apaf-1(h) <==> Hsp70-1(h):Apaf-1(h) (binding) | Hsp70-1(h) + Apaf-1L(h) <==> Hsp70-1(h):Apaf-1L(h) (binding) | bag1(m) + Hsp70-1(h) <==> bag1(m):Hsp70-1(h) (binding) | bag1(m) + Hsp40(h) + Hsp70-1(h) <==> bag1(m):Hsp40(h):Hsp70-1(h) (binding) | KSR(m) + Hsp90(h) + Hsp70-1(h) + Hsp68(h) + Hsp50(h) + MEK1(h){p} + MEK2(h){p} + 14-3-3(h) <==> KSR(m):Hsp90(h):Hsp70-1(h):Hsp68(h):Hsp50(h):MEK1(h){p}:MEK2(h){p}:14-3-3(h) (binding) | VHL(h) + TCP-1(h) + Hsp70-1(h) <==> VHL(h):TCP-1(h):Hsp70-1(h) (binding) | cd40(h) + Hsp70-1(h) + ADP <==> cd40(h):ADP:Hsp70-1(h) (binding) | parkin(h) + Hsp70-1(h) <==> parkin(h):Hsp70-1(h) (binding) | Glup(h) + Hsp70-1(h) <==> Glup(h):Hsp70-1(h) (binding) | Pael-R(h) + Hsp70-1(h) <==> Pael-R(h):Hsp70-1(h) (binding) | Hsp70-1(h) + CHIP(m) <==> Hsp70-1(h):CHIP(m) (binding) | Hsp70-1(h) + dihydrofolate reductase(c) <==> Hsp70-1(h):dihydrofolate reductase(c) (binding) | BAG5(h) + Hsp70-1(h) <==> BAG5(h):Hsp70-1(h) (binding) | Hsp70-1(h) + CHIP(m.s.) <==> Hsp70-1(h):CHIP(m.s.) (binding) | Hsp70-1(h) + AR(h) <==> Hsp70-1(h):AR(h) (binding) | Hsp70-1(h) + TRAF6(m.s.) <==> Hsp70-1(h):TRAF6(m.s.) (binding) | Hsp70-1(h) --> COX2(m) (increase of abundance) | Hsp70-1(h) --> iNOS(m) (increase of abundance) | Hsp70-1(h) --> TRAF6(m.s.){ub}n (decrease of ubiquitination) | RAP80(m.s.) + Hsp70-1(h) <==> RAP80(m.s.):Hsp70-1(h) (binding) | CHIP(h) + Hsp70-1(h) <==> CHIP(h):Hsp70-1(h) (binding) | Hsp70-1(h) + ErbB2(h) <==> Hsp70-1(h):ErbB2(h) (binding) | HDAC1(h) + Hsp70-1(h) <==> HDAC1(h):Hsp70-1(h) (binding) | hdac2(h) + Hsp70-1(h) <==> hdac2(h):Hsp70-1(h) (binding) | Hsp70-1(h) + HDAC3(h) <==> Hsp70-1(h):HDAC3(h) (binding) | STIP1(m.s.) + Hsp70-1(h) <==> STIP1(m.s.):Hsp70-1(h) (binding) | Hsp70-1(h) + Hip(m.s.) <==> Hsp70-1(h):Hip(m.s.) (binding) | Hsp70-1(h) + FKBP52(rb) <==> Hsp70-1(h):FKBP52(rb) (binding) | VHL(h):TCP-1(h):Hsp70-1(h) + ATP + elongin B(r) + elongin C(r) --> VHL(h):elongin B(r):elongin C(r) + TCP-1(h) + Hsp70-1(h) + ADP (binding; stabilization) | HSPA1A(h) --> Hsp70-1(h) (expression). | P2RX7(r) --> Hsp70-1(h) (binding) | LAMA3(h) --> Hsp70-1(h) (binding) | alpha-actinin-4(h) --> Hsp70-1(h) (binding) | SVIL(h) --> Hsp70-1(h) (binding) | Hsc70(h) --> Hsp70-1(h) (binding) | proCaspase-9(h) --Apaf-1L(h):dATP:Cytochrome C(b)--> Caspase-9-p35(h) + protein remnants (processing) | Hsp70-1(h) + LIMK1-isoform1(h) <==> Hsp70-1(h):LIMK1-isoform1(h) (binding) | Hsp70-1(h) + parkin-isoform1(h) <==> Hsp70-1(h):parkin-isoform1(h) (binding) | ubiquitin(h) + Hsp70-1(h) --parkin(h)--> Hsp70-1(h){ub(1)} (ubiquitination) | Hsp70-1(h) + 2 ubiquitin(h) --parkin(h)--> Hsp70-1(h){ub(2)} (ubiquitination) | Hsp70-1(h) + PR-alpha(c) + PR-beta(c) <==> Hsp70-1(h):PR-alpha(c):PR-beta(c) (binding) | HSJ2(h) + Hsp70-1(h) + PR-beta(c) + PR-alpha(c) <==> HSJ2(h):Hsp70-1(h):PR-beta(c):PR-alpha(c) (binding) | Hsp70-1(h) + ASK1(m.s.) <==> Hsp70-1(h):ASK1(m.s.) (binding) | AMPKbeta-2(h) + AMPKg(h) + AMPKbeta-1(h) + Hsp50(h) + alpha-tubulin 1B(h) + Hsp90-alpha(h) + Hsp70-1(h) + GRP78(h) + AMPKalpha-1(r) <==> AMPKbeta-2(h):AMPKg(h):AMPKbeta-1(h):Hsp50(h):alpha-tubulin 1B(h):Hsp90-alpha(h):Hsp70-1(h):GRP78(h):AMPKalpha-1(r) (binding) | 14-3-3epsilon(h) + 14-3-3zeta(h) + alpha-tubulin 1B(h) + Hsp70-1(h) + QSK(h) <==> 14-3-3epsilon(h):14-3-3zeta(h):alpha-tubulin 1B(h):Hsp70-1(h):QSK(h) (binding) | 14-3-3epsilon(h) + 14-3-3zeta(h) + alpha-tubulin 1B(h) + Hsp70-1(h) + SIK(h) <==> 14-3-3epsilon(h):14-3-3zeta(h):alpha-tubulin 1B(h):Hsp70-1(h):SIK(h) (binding) | PP2ACalpha(h) + B55A(h) + alpha-tubulin 1B(h) + PR65-beta(h) + Hsp70-1(h) + vcp(h) <==> PP2ACalpha(h):B55A(h):alpha-tubulin 1B(h):PR65-beta(h):Hsp70-1(h):vcp(h) (binding) | Hsp70-1(h) + nuak1(h) <==> Hsp70-1(h):nuak1(h) (binding) | Hsp50(h) + Hsp70-1(h) + Hsp90-alpha(h) + SNARK(h) <==> Hsp50(h):Hsp70-1(h):Hsp90-alpha(h):SNARK(h) (binding) | Hsp70-1(h) + BRSK1(h) <==> Hsp70-1(h):BRSK1(h) (binding) | alpha-tubulin 1B(h) + Hsp70-1(h) + BRSK2(h) <==> alpha-tubulin 1B(h):Hsp70-1(h):BRSK2(h) (binding) | 14-3-3epsilon(h) + 14-3-3zeta(h) + alpha-tubulin 1B(h) + Hsp70-1(h) + mark1(h) <==> 14-3-3epsilon(h):14-3-3zeta(h):alpha-tubulin 1B(h):Hsp70-1(h):mark1(h) (binding) | 14-3-3epsilon(h) + 14-3-3zeta(h) + Hsp70-1(h) + MARK2(h) <==> 14-3-3epsilon(h):14-3-3zeta(h):Hsp70-1(h):MARK2(h) (binding) | 14-3-3epsilon(h) + 14-3-3zeta(h) + Hsp70-1(h) + CTAK1(m) <==> 14-3-3epsilon(h):14-3-3zeta(h):Hsp70-1(h):CTAK1(m) (binding) | 14-3-3epsilon(h) + 14-3-3zeta(h) + alpha-tubulin 1B(h) + Hsp70-1(h) + MARK4(h) <==> 14-3-3epsilon(h):14-3-3zeta(h):alpha-tubulin 1B(h):Hsp70-1(h):MARK4(h) (binding) | Hsp70-1(h) + SNRK(h) <==> Hsp70-1(h):SNRK(h) (binding) | Hsp70-1(h) --/ melanin (decrease of abundance) | Hsp70-1(h) --/ tyrosinase(m) (decrease of abundance) | Hsp70-1(h) --/ Tyr(m) (transrepression) | Hsp70-1(h) --/ Tyrp1(m) (transrepression) | Hsp70-1(h) --/ Dct(m) (transrepression) | Hsp70-1(h) --/ Ppme1(m) (transrepression) | Hsp70-1(h) + MITF(m){p} <==> Hsp70-1(h):MITF(m){p} (binding) | HSPA1A(h) --> Hsp70-1(h) (expression). | HSPA1A(h) --> hsp70(h) (expression). | hsa-miR-1 --/ hsp70(h) (translational repression). |
|---|
Post Translational Modification [Top] | |||
There is no record for HSPA1A | |||
Methylation Profile [Top] | ||
There is no record for HSPA1A | ||